ChemNet > CAS > 1947-47-3 3-Amino-2-phenylindenone
1947-47-3 3-Amino-2-phenylindenone
produktnavn |
3-Amino-2-phenylindenone |
Engelsk navn |
3-Amino-2-phenylindenone; 3-Amino-2-phenyl-1H-inden-1-one; (2R,3Z)-3-imino-2-phenyl-2,3-dihydro-1H-inden-1-one |
Molekylær Formel |
C15H11NO |
Molekylvekt |
221.2539 |
InChI |
InChI=1/C15H11NO/c16-14-11-8-4-5-9-12(11)15(17)13(14)10-6-2-1-3-7-10/h1-9,13,16H/b16-14+/t13-/m1/s1 |
CAS-nummer |
1947-47-3 |
Molecular Structure |
|
Tetthet |
1.21g/cm3 |
Smeltepunkt |
270℃ |
Kokepunkt |
415.6°C at 760 mmHg |
Brytningsindeks |
1.652 |
Flammepunktet |
205.1°C |
Damptrykk |
4.09E-07mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|