ChemNet > CAS > 1948-40-9 3,5-Diiodo-4-hydroxybenzaldehyde
1948-40-9 3,5-Diiodo-4-hydroxybenzaldehyde
produktnavn |
3,5-Diiodo-4-hydroxybenzaldehyde |
Engelsk navn |
3,5-Diiodo-4-hydroxybenzaldehyde; 4-hydroxy-3,5-diiodobenzaldehyde |
Molekylær Formel |
C7H4I2O2 |
Molekylvekt |
373.9144 |
InChI |
InChI=1/C7H4I2O2/c8-5-1-4(3-10)2-6(9)7(5)11/h1-3,11H |
CAS-nummer |
1948-40-9 |
EINECS |
217-754-3 |
Molecular Structure |
|
Tetthet |
2.602g/cm3 |
Kokepunkt |
284.1°C at 760 mmHg |
Brytningsindeks |
1.787 |
Flammepunktet |
125.6°C |
Damptrykk |
0.00177mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|