ChemNet > CAS > 19819-95-5 2-Chlorophenethylalcohol
19819-95-5 2-Chlorophenethylalcohol
produktnavn |
2-Chlorophenethylalcohol |
Engelsk navn |
2-Chlorophenethylalcohol; 2-(2-Chlorophenyl)ethanol |
Molekylær Formel |
C8H9ClO |
Molekylvekt |
156.6095 |
InChI |
InChI=1/C8H9ClO/c9-8-4-2-1-3-7(8)5-6-10/h1-4,10H,5-6H2 |
CAS-nummer |
19819-95-5 |
EINECS |
243-348-0 |
Molecular Structure |
|
Tetthet |
1.189g/cm3 |
Kokepunkt |
227.5°C at 760 mmHg |
Brytningsindeks |
1.554 |
Flammepunktet |
101.1°C |
Damptrykk |
0.0435mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|