ChemNet > CAS > 199866-90-5 1,4-difluoro-2,5-dimethoxybenzene
199866-90-5 1,4-difluoro-2,5-dimethoxybenzene
| produktnavn |
1,4-difluoro-2,5-dimethoxybenzene |
| Engelsk navn |
1,4-difluoro-2,5-dimethoxybenzene; |
| Molekylær Formel |
C8H8F2O2 |
| Molekylvekt |
174.1447 |
| InChI |
InChI=1/C8H8F2O2/c1-11-7-3-6(10)8(12-2)4-5(7)9/h3-4H,1-2H3 |
| CAS-nummer |
199866-90-5 |
| Molecular Structure |
|
| Tetthet |
1.193g/cm3 |
| Kokepunkt |
193.7°C at 760 mmHg |
| Brytningsindeks |
1.455 |
| Flammepunktet |
77.4°C |
| Damptrykk |
0.64mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
