ChemNet > CAS > 20323-74-4 Ethyl 2-amino-4,5-dimethoxybenzoate
20323-74-4 Ethyl 2-amino-4,5-dimethoxybenzoate
produktnavn |
Ethyl 2-amino-4,5-dimethoxybenzoate |
Engelsk navn |
Ethyl 2-amino-4,5-dimethoxybenzoate; 2-Amino-4,5-dimethoxybenzoic acid ethyl ester |
Molekylær Formel |
C11H15NO4 |
Molekylvekt |
225.2411 |
InChI |
InChI=1/C11H15NO4/c1-4-16-11(13)7-5-9(14-2)10(15-3)6-8(7)12/h5-6H,4,12H2,1-3H3 |
CAS-nummer |
20323-74-4 |
EINECS |
243-732-8 |
Molecular Structure |
|
Tetthet |
1.16g/cm3 |
Kokepunkt |
355.9°C at 760 mmHg |
Brytningsindeks |
1.533 |
Flammepunktet |
164°C |
Damptrykk |
3.02E-05mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|