ChemNet > CAS > 2049-67-4 diethyl glutaconate, mixture of cis and tra
2049-67-4 diethyl glutaconate, mixture of cis and tra
| produktnavn |
diethyl glutaconate, mixture of cis and tra |
| Engelsk navn |
diethyl glutaconate, mixture of cis and tra; Diethyl glutaconate,mixture of cis and trans; diethyl pent-2-enedioate; diethyl (2E)-pent-2-enedioate; diethyl (2Z)-pent-2-enedioate; 2-Pentenedioic acid,1,5-diethyl ester; Diethyl glutaconate |
| Molekylær Formel |
C9H14O4 |
| Molekylvekt |
186.2051 |
| InChI |
InChI=1/C9H14O4/c1-3-12-8(10)6-5-7-9(11)13-4-2/h5-6H,3-4,7H2,1-2H3/b6-5- |
| CAS-nummer |
2049-67-4 |
| EINECS |
218-069-2 |
| Molecular Structure |
|
| Tetthet |
1.048g/cm3 |
| Kokepunkt |
237°C at 760 mmHg |
| Brytningsindeks |
1.445 |
| Flammepunktet |
106.7°C |
| Damptrykk |
0.0459mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
|
|
