ChemNet > CAS > 2058-74-4 1-Methylisatin
2058-74-4 1-Methylisatin
| produktnavn |
1-Methylisatin |
| Engelsk navn |
1-Methylisatin; Methylisatintech; 1-methyl-2,3-dihydroindole-2,3-dione; N-Methylsatin; 1-Methyl-2,3-indolinedione; 1-methyl-1H-indole-2,3-dione; 1-Methylindoline-2,3-Dione |
| Molekylær Formel |
C9H7NO2 |
| Molekylvekt |
161.1574 |
| InChI |
InChI=1/C9H7NO2/c1-10-7-5-3-2-4-6(7)8(11)9(10)12/h2-5H,1H3 |
| CAS-nummer |
2058-74-4 |
| EINECS |
218-164-9 |
| Molecular Structure |
|
| Tetthet |
1.314g/cm3 |
| Smeltepunkt |
129-133℃ |
| Kokepunkt |
294.3°C at 760 mmHg |
| Brytningsindeks |
1.607 |
| Flammepunktet |
137.4°C |
| Damptrykk |
0.00164mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
