ChemNet > CAS > 2083-09-2 2,5-Bis(4-biphenylyl)oxazole
2083-09-2 2,5-Bis(4-biphenylyl)oxazole
produktnavn |
2,5-Bis(4-biphenylyl)oxazole |
Engelsk navn |
2,5-Bis(4-biphenylyl)oxazole; 2,5-di(biphenyl-4-yl)oxazole; 2,5-Bis(4-biphenyl)oxazole; BBO; 2,5-di(biphenyl-4-yl)-1,3-oxazole |
Molekylær Formel |
C27H19NO |
Molekylvekt |
373.4459 |
InChI |
InChI=1/C27H19NO/c1-3-7-20(8-4-1)22-11-15-24(16-12-22)26-19-28-27(29-26)25-17-13-23(14-18-25)21-9-5-2-6-10-21/h1-19H |
CAS-nummer |
2083-09-2 |
EINECS |
218-220-2 |
Molecular Structure |
|
Tetthet |
1.143g/cm3 |
Smeltepunkt |
238-240℃ |
Kokepunkt |
592.4°C at 760 mmHg |
Brytningsindeks |
1.621 |
Flammepunktet |
259.6°C |
Damptrykk |
2.22E-13mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|