ChemNet > CAS > 2088-24-6 3-Methoxyphenoxyacetic acid
2088-24-6 3-Methoxyphenoxyacetic acid
| produktnavn |
3-Methoxyphenoxyacetic acid |
| Engelsk navn |
3-Methoxyphenoxyacetic acid;Acetic acid, (3-methoxyphenoxy)-; (3-Methoxyphenoxy)acetic acid |
| Molekylær Formel |
C9H10O4 |
| Molekylvekt |
182.1733 |
| InChI |
InChI=1/C9H10O4/c1-12-7-3-2-4-8(5-7)13-6-9(10)11/h2-5H,6H2,1H3,(H,10,11) |
| CAS-nummer |
2088-24-6 |
| Molecular Structure |
|
| Tetthet |
1.226g/cm3 |
| Kokepunkt |
325.9°C at 760 mmHg |
| Brytningsindeks |
1.528 |
| Flammepunktet |
131.9°C |
| Damptrykk |
9.11E-05mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
