ChemNet > CAS > 20949-81-9 2-phenyl-1,3-thiazole-4-carbaldehyde
20949-81-9 2-phenyl-1,3-thiazole-4-carbaldehyde
| produktnavn |
2-phenyl-1,3-thiazole-4-carbaldehyde |
| Engelsk navn |
2-phenyl-1,3-thiazole-4-carbaldehyde; 2-phenylthiazole-4-carbaldehyde |
| Molekylær Formel |
C10H7NOS |
| Molekylvekt |
189.2337 |
| InChI |
InChI=1/C10H7NOS/c12-6-9-7-13-10(11-9)8-4-2-1-3-5-8/h1-7H |
| CAS-nummer |
20949-81-9 |
| Molecular Structure |
|
| Tetthet |
1.269g/cm3 |
| Smeltepunkt |
45℃ |
| Kokepunkt |
353°C at 760 mmHg |
| Brytningsindeks |
1.645 |
| Flammepunktet |
167.3°C |
| Damptrykk |
3.7E-05mmHg at 25°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
