ChemNet > CAS > 213270-36-1 (S)-2-Isobutylsuccinic acid-1-methyl ester
213270-36-1 (S)-2-Isobutylsuccinic acid-1-methyl ester
produktnavn |
(S)-2-Isobutylsuccinic acid-1-methyl ester |
Engelsk navn |
(S)-2-Isobutylsuccinic acid-1-methyl ester; (S)-3-Methoxycarbonyl-5-methylhexanoic acid; (S)-(-)-2-Isobutylsuccinic acid 1-methyl ester; (3S)-3-(methoxycarbonyl)-5-methylhexanoic acid; (3S)-3-(methoxycarbonyl)-5-methylhexanoate; 3-(methoxycarbonyl)-5-methylhexanoic acid |
Molekylær Formel |
C9H16O4 |
Molekylvekt |
188.2209 |
InChI |
InChI=1/C9H16O4/c1-6(2)4-7(5-8(10)11)9(12)13-3/h6-7H,4-5H2,1-3H3,(H,10,11) |
CAS-nummer |
213270-36-1 |
Molecular Structure |
|
Tetthet |
1.07g/cm3 |
Kokepunkt |
288.632°C at 760 mmHg |
Brytningsindeks |
1.447 |
Flammepunktet |
107.989°C |
Damptrykk |
0.001mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|