ChemNet > CAS > 215655-20-2 1-(2-chloro-6-fluorobenzyl)piperazine
215655-20-2 1-(2-chloro-6-fluorobenzyl)piperazine
produktnavn |
1-(2-chloro-6-fluorobenzyl)piperazine |
Engelsk navn |
1-(2-chloro-6-fluorobenzyl)piperazine; |
Molekylær Formel |
C11H14ClFN2 |
Molekylvekt |
228.6937 |
InChI |
InChI=1/C11H14ClFN2/c12-10-2-1-3-11(13)9(10)8-15-6-4-14-5-7-15/h1-3,14H,4-8H2 |
CAS-nummer |
215655-20-2 |
Molecular Structure |
|
Tetthet |
1.216g/cm3 |
Kokepunkt |
299.7°C at 760 mmHg |
Brytningsindeks |
1.544 |
Flammepunktet |
135°C |
Damptrykk |
0.00118mmHg at 25°C |
Hazard symboler |
C:Corrosive;
|
Risiko Koder |
R34:Causes burns.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|