ChemNet > CAS > 21622-18-4 2,3,4,5-Tetrafluorobenzylchloride
21622-18-4 2,3,4,5-Tetrafluorobenzylchloride
| produktnavn |
2,3,4,5-Tetrafluorobenzylchloride |
| Engelsk navn |
2,3,4,5-Tetrafluorobenzylchloride; 2,3,4,6-Tetrafluorobenzyl chloride; 2-(chloromethyl)-1,3,4,5-tetrafluorobenzene |
| Molekylær Formel |
C7H3ClF4 |
| Molekylvekt |
198.5453 |
| InChI |
InChI=1/C7H3ClF4/c8-2-3-4(9)1-5(10)7(12)6(3)11/h1H,2H2 |
| CAS-nummer |
21622-18-4 |
| Molecular Structure |
|
| Tetthet |
1.482g/cm3 |
| Kokepunkt |
164.1°C at 760 mmHg |
| Brytningsindeks |
1.449 |
| Flammepunktet |
57.5°C |
| Damptrykk |
2.62mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R34:Causes burns.;
R37:Irritating to respiratory system.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
