ChemNet > CAS > 216393-55-4 Methyl 3,5-difluorobenzoate
216393-55-4 Methyl 3,5-difluorobenzoate
| produktnavn |
Methyl 3,5-difluorobenzoate |
| Engelsk navn |
Methyl 3,5-difluorobenzoate; 3,5-Difluorobenzoic acid methyl ester |
| Molekylær Formel |
C8H6F2O2 |
| Molekylvekt |
172.1288 |
| InChI |
InChI=1/C8H6F2O2/c1-12-8(11)5-2-6(9)4-7(10)3-5/h2-4H,1H3 |
| CAS-nummer |
216393-55-4 |
| Molecular Structure |
|
| Tetthet |
1.268g/cm3 |
| Kokepunkt |
202.7°C at 760 mmHg |
| Brytningsindeks |
1.472 |
| Flammepunktet |
74.6°C |
| Damptrykk |
0.288mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R36/38:Irritating to eyes and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
