ChemNet > CAS > 22225-77-0 2-(difluoromethoxy)nitrobenzene
22225-77-0 2-(difluoromethoxy)nitrobenzene
| produktnavn |
2-(difluoromethoxy)nitrobenzene |
| Engelsk navn |
2-(difluoromethoxy)nitrobenzene; 1-(Difluoromethoxy)-2-nitrobenzene |
| Molekylær Formel |
C7H5F2NO3 |
| Molekylvekt |
189.1163 |
| InChI |
InChI=1/C7H5F2NO3/c8-7(9)13-6-4-2-1-3-5(6)10(11)12/h1-4,7H |
| CAS-nummer |
22225-77-0 |
| Molecular Structure |
|
| Tetthet |
1.384g/cm3 |
| Kokepunkt |
249.4°C at 760 mmHg |
| Brytningsindeks |
1.494 |
| Flammepunktet |
104.6°C |
| Damptrykk |
0.0363mmHg at 25°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
