ChemNet > CAS > 22237-12-3 (3-Amino-4-methylphenyl)boronic acid, hydrochloride
22237-12-3 (3-Amino-4-methylphenyl)boronic acid, hydrochloride
| produktnavn |
(3-Amino-4-methylphenyl)boronic acid, hydrochloride |
| Engelsk navn |
(3-Amino-4-methylphenyl)boronic acid, hydrochloride; 3-Amino-4-methylphenylboronic acid~3-Amino-p-tolylboronic acid; 3-Amino-4-methylbenzeneboronic acid; 5-(dihydroxyboranyl)-2-methylanilinium chloride; (3-amino-4-methylphenyl)boronic acid; 3-Amino-4-Methylphenylboronic Acid Hydrochloride |
| Molekylær Formel |
C7H10BNO2 |
| Molekylvekt |
150.9708 |
| InChI |
InChI=1/C7H10BNO2/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4,10-11H,9H2,1H3 |
| CAS-nummer |
22237-12-3 |
| Molecular Structure |
|
| Tetthet |
1.19g/cm3 |
| Kokepunkt |
367.6°C at 760 mmHg |
| Brytningsindeks |
1.569 |
| Flammepunktet |
176.1°C |
| Damptrykk |
4.73E-06mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
