2243-42-7 2-Phenoxybenzoic acid
produktnavn |
2-Phenoxybenzoic acid |
Engelsk navn |
2-Phenoxybenzoic acid; 2-Carboxydiphenyl ether; 2-phenoxybenzoate |
Molekylær Formel |
C13H9O3 |
Molekylvekt |
213.2093 |
InChI |
InChI=1/C13H10O3/c14-13(15)11-8-4-5-9-12(11)16-10-6-2-1-3-7-10/h1-9H,(H,14,15)/p-1 |
CAS-nummer |
2243-42-7 |
EINECS |
218-811-5 |
Molecular Structure |
|
Smeltepunkt |
111-115℃ |
Kokepunkt |
343.3°C at 760 mmHg |
Flammepunktet |
132°C |
Damptrykk |
2.73E-05mmHg at 25°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|