ChemNet > CAS > 2315-86-8 3-Bromo-4-hydroxybenzonitrile
2315-86-8 3-Bromo-4-hydroxybenzonitrile
produktnavn |
3-Bromo-4-hydroxybenzonitrile |
Engelsk navn |
3-Bromo-4-hydroxybenzonitrile; 2-Bromo-4-cyanophenol |
Molekylær Formel |
C7H4BrNO |
Molekylvekt |
198.0168 |
InChI |
InChI=1/C7H4BrNO/c8-6-3-5(4-9)1-2-7(6)10/h1-3,10H |
CAS-nummer |
2315-86-8 |
EINECS |
219-022-9 |
Molecular Structure |
|
Tetthet |
1.79g/cm3 |
Smeltepunkt |
155℃ |
Kokepunkt |
271.1°C at 760 mmHg |
Brytningsindeks |
1.656 |
Flammepunktet |
117.8°C |
Damptrykk |
0.00396mmHg at 25°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|