ChemNet > CAS > 2349-58-8 4,5-Diphenyl-2-imidazolethiol
2349-58-8 4,5-Diphenyl-2-imidazolethiol
produktnavn |
4,5-Diphenyl-2-imidazolethiol |
Engelsk navn |
4,5-Diphenyl-2-imidazolethiol; 2,3-Diphenyl-1-indenone; 4,5-diphenyl-1,3-dihydro-2H-imidazole-2-thione |
Molekylær Formel |
C15H12N2S |
Molekylvekt |
252.3342 |
InChI |
InChI=1/C15H12N2S/c18-15-16-13(11-7-3-1-4-8-11)14(17-15)12-9-5-2-6-10-12/h1-10H,(H2,16,17,18) |
CAS-nummer |
2349-58-8 |
EINECS |
219-077-9 |
Molecular Structure |
|
Tetthet |
1.29g/cm3 |
Smeltepunkt |
300℃ |
Kokepunkt |
407.5°C at 760 mmHg |
Brytningsindeks |
1.724 |
Flammepunktet |
200.3°C |
Damptrykk |
7.51E-07mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|