ChemNet > CAS > 2379-55-7 2,3-Dimethylquinoxaline
2379-55-7 2,3-Dimethylquinoxaline
| produktnavn |
2,3-Dimethylquinoxaline |
| Engelsk navn |
2,3-Dimethylquinoxaline;Quinoxaline, 2,3-dimethyl-; 5-23-07-00267 (Beilstein Handbook Reference); BRN 0114832; NSC 1789 |
| Molekylær Formel |
C10H10N2 |
| Molekylvekt |
158.1998 |
| InChI |
InChI=1/C10H10N2/c1-7-8(2)12-10-6-4-3-5-9(10)11-7/h3-6H,1-2H3 |
| CAS-nummer |
2379-55-7 |
| EINECS |
219-162-0 |
| Molecular Structure |
|
| Tetthet |
1.109g/cm3 |
| Smeltepunkt |
102-107℃ |
| Kokepunkt |
257.3°C at 760 mmHg |
| Brytningsindeks |
1.617 |
| Flammepunktet |
105.3°C |
| Damptrykk |
0.0236mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
