2393-17-1 Aminohydrocinnamicacid
produktnavn |
Aminohydrocinnamicacid |
Engelsk navn |
Aminohydrocinnamicacid; 4-Aminohydrocinnamic acid; 3-(4-aminophenyl)propanoic acid |
Molekylær Formel |
C9H11NO2 |
Molekylvekt |
165.1891 |
InChI |
InChI=1/C9H11NO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-2,4-5H,3,6,10H2,(H,11,12) |
CAS-nummer |
2393-17-1 |
EINECS |
219-245-1 |
Molecular Structure |
|
Tetthet |
1.217g/cm3 |
Kokepunkt |
351°C at 760 mmHg |
Brytningsindeks |
1.597 |
Flammepunktet |
166.1°C |
Damptrykk |
1.57E-05mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|