ChemNet > CAS > 2393-97-7 Bis-(4-chlorophenylthio)methane
2393-97-7 Bis-(4-chlorophenylthio)methane
produktnavn |
Bis-(4-chlorophenylthio)methane |
Engelsk navn |
Bis-(4-chlorophenylthio)methane; Bis(4-chlorophenylthio)methane; 1,1'-(methanediyldisulfanediyl)bis(4-chlorobenzene) |
Molekylær Formel |
C13H10Cl2S2 |
Molekylvekt |
301.2545 |
InChI |
InChI=1/C13H10Cl2S2/c14-10-1-5-12(6-2-10)16-9-17-13-7-3-11(15)4-8-13/h1-8H,9H2 |
CAS-nummer |
2393-97-7 |
Molecular Structure |
|
Tetthet |
1.38g/cm3 |
Smeltepunkt |
45-48℃ |
Kokepunkt |
420.9°C at 760 mmHg |
Brytningsindeks |
1.677 |
Flammepunktet |
192.5°C |
Damptrykk |
6.64E-07mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|