ChemNet > CAS > 24068-15-3 2-klormetyl-5-(4-klorfenyl)-1,2,4-oksadiazol
24068-15-3 2-klormetyl-5-(4-klorfenyl)-1,2,4-oksadiazol
produktnavn |
2-klormetyl-5-(4-klorfenyl)-1,2,4-oksadiazol |
Synonymer |
; 2-klormetyl-5-(4-klorfenyl)-1,3,4-oksadiazol |
Engelsk navn |
2-Chloromethyl-5-(4-chlorophenyl)-1,2,4-oxadiazole; 2-Chloromethyl-5-(4-chlorophenyl)-1,3,4-oxadiazole |
Molekylær Formel |
C9H6Cl2N2O |
Molekylvekt |
229.0627 |
InChI |
InChI=1/C9H6Cl2N2O/c10-5-8-12-13-9(14-8)6-1-3-7(11)4-2-6/h1-4H,5H2 |
CAS-nummer |
24068-15-3 |
Molecular Structure |
|
Tetthet |
1.4g/cm3 |
Smeltepunkt |
81℃ |
Kokepunkt |
343.8°C at 760 mmHg |
Brytningsindeks |
1.574 |
Flammepunktet |
161.7°C |
Damptrykk |
0.000136mmHg at 25°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|