ChemNet > CAS > 24426-16-2 N,N-Diethyldiethylenetriamine
24426-16-2 N,N-Diethyldiethylenetriamine
produktnavn |
N,N-Diethyldiethylenetriamine |
Engelsk navn |
N,N-Diethyldiethylenetriamine; N,N-Diethyldiethykenetriamine; N-(2-Diethylaminoethyl)ethylenediamine; N'-(2-aminoethyl)-N,N-diethylethane-1,2-diamine; N'-(2-ammonioethyl)-N,N-diethylethane-1,2-diaminium |
Molekylær Formel |
C8H24N3 |
Molekylvekt |
162.2946 |
InChI |
InChI=1/C8H21N3/c1-3-11(4-2)8-7-10-6-5-9/h10H,3-9H2,1-2H3/p+3 |
CAS-nummer |
24426-16-2 |
EINECS |
246-242-2 |
Molecular Structure |
|
Kokepunkt |
227°C at 760 mmHg |
Flammepunktet |
91.1°C |
Damptrykk |
0.0796mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R34:Causes burns.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|