24464-63-9 n-Decylboronic acid
produktnavn |
n-Decylboronic acid |
Engelsk navn |
n-Decylboronic acid; n-Decaneboronic acid; decylboronic acid |
Molekylær Formel |
C10H23BO2 |
Molekylvekt |
186.0994 |
InChI |
InChI=1/C10H23BO2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h12-13H,2-10H2,1H3 |
CAS-nummer |
24464-63-9 |
Molecular Structure |
|
Tetthet |
0.883g/cm3 |
Kokepunkt |
297.1°C at 760 mmHg |
Brytningsindeks |
1.434 |
Flammepunktet |
133.5°C |
Damptrykk |
0.000141mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|