ChemNet > CAS > 2454-37-7 3-(1-Hydroxyethyl)aniline
2454-37-7 3-(1-Hydroxyethyl)aniline
| produktnavn |
3-(1-Hydroxyethyl)aniline |
| Engelsk navn |
3-(1-Hydroxyethyl)aniline; 1-(3-Aminophenyl)ethanol; 3-Amino-alpha-methylbenzyl alcohol~3-Aminophenyl methyl carbinol~3-(alpha-Hydroxyethyl)aniline; (1R)-1-(3-aminophenyl)ethanol; (1S)-1-(3-aminophenyl)ethanol |
| Molekylær Formel |
C8H11NO |
| Molekylvekt |
137.179 |
| InChI |
InChI=1/C8H11NO/c1-6(10)7-3-2-4-8(9)5-7/h2-6,10H,9H2,1H3/t6-/m0/s1 |
| CAS-nummer |
2454-37-7 |
| EINECS |
219-525-3 |
| Molecular Structure |
|
| Tetthet |
1.117g/cm3 |
| Smeltepunkt |
66-70℃ |
| Kokepunkt |
285°C at 760 mmHg |
| Brytningsindeks |
1.592 |
| Flammepunktet |
126.1°C |
| Damptrykk |
0.00135mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
