ChemNet > CAS > 25115-74-6 4-Cyano-4-phenylcyclohexanone
25115-74-6 4-Cyano-4-phenylcyclohexanone
| produktnavn |
4-Cyano-4-phenylcyclohexanone |
| Engelsk navn |
4-Cyano-4-phenylcyclohexanone; 4-oxo-1-phenylcyclohexanenitrile; 4-oxo-1-phenylcyclohexanecarbonitrile |
| Molekylær Formel |
C13H13NO |
| Molekylvekt |
199.2484 |
| InChI |
InChI=1/C13H13NO/c14-10-13(8-6-12(15)7-9-13)11-4-2-1-3-5-11/h1-5H,6-9H2 |
| CAS-nummer |
25115-74-6 |
| EINECS |
246-631-7 |
| Molecular Structure |
|
| Tetthet |
1.12g/cm3 |
| Smeltepunkt |
114-119℃ |
| Kokepunkt |
378.6°C at 760 mmHg |
| Brytningsindeks |
1.557 |
| Flammepunktet |
182.8°C |
| Damptrykk |
6.22E-06mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
