25309-64-2 4-Ethyliodobenzene
produktnavn |
4-Ethyliodobenzene |
Engelsk navn |
4-Ethyliodobenzene; 1-Ethyl-4-iodobenzene; 2-chlorocyclohexyl oxo(phenyl)acetate |
Molekylær Formel |
C8H9I |
Molekylvekt |
232.0615 |
InChI |
InChI=1/C8H9I/c1-2-7-3-5-8(9)6-4-7/h3-6H,2H2,1H3 |
CAS-nummer |
25309-64-2 |
Molecular Structure |
|
Tetthet |
1.607g/cm3 |
Kokepunkt |
209.6°C at 760 mmHg |
Brytningsindeks |
1.59 |
Flammepunktet |
88.6°C |
Damptrykk |
0.291mmHg at 25°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|