25870-62-6 1-Phenyl-2-hexanone
produktnavn |
1-Phenyl-2-hexanone |
Engelsk navn |
1-Phenyl-2-hexanone; Benzyl n-butyl ketone; 1-phenylhexan-2-one |
Molekylær Formel |
C12H16O |
Molekylvekt |
176.2548 |
InChI |
InChI=1/C12H16O/c1-2-3-9-12(13)10-11-7-5-4-6-8-11/h4-8H,2-3,9-10H2,1H3 |
CAS-nummer |
25870-62-6 |
EINECS |
247-306-2 |
Molecular Structure |
|
Tetthet |
0.95g/cm3 |
Kokepunkt |
258°C at 760 mmHg |
Brytningsindeks |
1.498 |
Flammepunktet |
104.2°C |
Damptrykk |
0.0141mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|