ChemNet > CAS > 2596-47-6 4-Acetoxy-3-methoxycinnamic acid
2596-47-6 4-Acetoxy-3-methoxycinnamic acid
| produktnavn |
4-Acetoxy-3-methoxycinnamic acid |
| Engelsk navn |
4-Acetoxy-3-methoxycinnamic acid;2-Propenoic acid, 3-(4-(acetyloxy)-3-methoxyphenyl)-; 3-Methoxy-4-acetoxycinnamic acid; AI3-23455; Acetylferulic acid; Cinnamic acid, 4-acetoxy-3-methoxy-; Cinnamic acid, 4-hydroxy-3-methoxy-, acetate; NSC 16957; 3-[4-(acetyloxy)-3-methoxyphenyl]prop-2-enoic acid; (2E)-3-[4-(acetyloxy)-3-methoxyphenyl]prop-2-enoic acid |
| Molekylær Formel |
C12H12O5 |
| Molekylvekt |
236.2207 |
| InChI |
InChI=1/C12H12O5/c1-8(13)17-10-5-3-9(4-6-12(14)15)7-11(10)16-2/h3-7H,1-2H3,(H,14,15)/b6-4+ |
| CAS-nummer |
2596-47-6 |
| Molecular Structure |
|
| Tetthet |
1.265g/cm3 |
| Kokepunkt |
371.9°C at 760 mmHg |
| Brytningsindeks |
1.575 |
| Flammepunktet |
141.6°C |
| Damptrykk |
3.44E-06mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
