ChemNet > CAS > 261763-37-5 2,3-Difluoro-4-methylbenzoic acid
261763-37-5 2,3-Difluoro-4-methylbenzoic acid
produktnavn |
2,3-Difluoro-4-methylbenzoic acid |
Engelsk navn |
2,3-Difluoro-4-methylbenzoic acid; 2,3-Difluoro-p-toluic acid |
Molekylær Formel |
C8H6F2O2 |
Molekylvekt |
172.1288 |
InChI |
InChI=1/C8H6F2O2/c1-4-2-3-5(8(11)12)7(10)6(4)9/h2-3H,1H3,(H,11,12) |
CAS-nummer |
261763-37-5 |
Molecular Structure |
|
Tetthet |
1.359g/cm3 |
Kokepunkt |
274°C at 760 mmHg |
Brytningsindeks |
1.511 |
Flammepunktet |
119.5°C |
Damptrykk |
0.0027mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|