ChemNet > CAS > 26782-74-1 (S)-2-chloro-3-methylbutyric acid
26782-74-1 (S)-2-chloro-3-methylbutyric acid
produktnavn |
(S)-2-chloro-3-methylbutyric acid |
Engelsk navn |
(S)-2-chloro-3-methylbutyric acid; (S)-(-)-2-Chloro-3-methylbutyric acid; S-2-chloro-3-methylbutyric acid; (2S)-2-chloro-3-methylbutanoic acid |
Molekylær Formel |
C5H9ClO2 |
Molekylvekt |
136.5768 |
InChI |
InChI=1/C5H9ClO2/c1-3(2)4(6)5(7)8/h3-4H,1-2H3,(H,7,8)/t4-/m0/s1 |
CAS-nummer |
26782-74-1 |
Molecular Structure |
|
Tetthet |
1.159g/cm3 |
Kokepunkt |
210.3°C at 760 mmHg |
Brytningsindeks |
1.447 |
Flammepunktet |
81°C |
Damptrykk |
0.0768mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R34:Causes burns.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|