2694-54-4 Triallyl Trimellitate
produktnavn |
Triallyl Trimellitate |
Engelsk navn |
Triallyl Trimellitate; 1,2,4-Benzenetricarboxylic acid triallyl ester; Trimellitic acid triallyl ester; triprop-2-en-1-yl benzene-1,2,4-tricarboxylate |
Molekylær Formel |
C18H18O6 |
Molekylvekt |
330.3319 |
InChI |
InChI=1/C18H18O6/c1-4-9-22-16(19)13-7-8-14(17(20)23-10-5-2)15(12-13)18(21)24-11-6-3/h4-8,12H,1-3,9-11H2 |
CAS-nummer |
2694-54-4 |
EINECS |
220-264-2 |
Molecular Structure |
|
Tetthet |
1.149g/cm3 |
Kokepunkt |
438.1°C at 760 mmHg |
Brytningsindeks |
1.528 |
Flammepunktet |
191.3°C |
Damptrykk |
7.07E-08mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R36/38:Irritating to eyes and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|