ChemNet > CAS > 27006-82-2 5-klor-1,3-dimetyl-1H-pyrazol-4-karboksylsyre
27006-82-2 5-klor-1,3-dimetyl-1H-pyrazol-4-karboksylsyre
| produktnavn |
5-klor-1,3-dimetyl-1H-pyrazol-4-karboksylsyre |
| Engelsk navn |
5-chloro-1,3-dimethyl-1H-pyrazole-4-carboxylic acid; |
| Molekylær Formel |
C6H7ClN2O2 |
| Molekylvekt |
174.585 |
| InChI |
InChI=1/C6H7ClN2O2/c1-3-4(6(10)11)5(7)9(2)8-3/h1-2H3,(H,10,11) |
| CAS-nummer |
27006-82-2 |
| Molecular Structure |
|
| Tetthet |
1.47g/cm3 |
| Smeltepunkt |
198℃ |
| Kokepunkt |
316.1°C at 760 mmHg |
| Brytningsindeks |
1.603 |
| Flammepunktet |
145°C |
| Damptrykk |
0.000177mmHg at 25°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
