27638-00-2 dilaurin (C12:0)
| produktnavn |
dilaurin (C12:0) |
| Synonymer |
Dilaurin; Dodekansyre, diester med 1,2,3-propantriol; Glyserol dilaurat; Laurinsyre, diester med glyserol; 3-hydroksypropan-1,2-diyldidodecanoat |
| Engelsk navn |
dilaurin (C12:0);Dilaurin; Dodecanoic acid, diester with 1,2,3-propanetriol; Glyceryl dilaurate; Lauric acid, diester with glycerol; 3-hydroxypropane-1,2-diyl didodecanoate |
| Molekylær Formel |
C27H52O5 |
| Molekylvekt |
456.6988 |
| InChI |
InChI=1/C27H52O5/c1-3-5-7-9-11-13-15-17-19-21-26(29)31-24-25(23-28)32-27(30)22-20-18-16-14-12-10-8-6-4-2/h25,28H,3-24H2,1-2H3 |
| CAS-nummer |
27638-00-2 |
| EINECS |
248-586-9 |
| Molecular Structure |
|
| Tetthet |
0.953g/cm3 |
| Kokepunkt |
531°C at 760 mmHg |
| Brytningsindeks |
1.463 |
| Flammepunktet |
158°C |
| Damptrykk |
1.71E-13mmHg at 25°C |
|