ChemNet > CAS > 28098-03-5 oktansyre, forbindelse med 2-aminoetanol (1: 1)
28098-03-5 oktansyre, forbindelse med 2-aminoetanol (1: 1)
| produktnavn |
oktansyre, forbindelse med 2-aminoetanol (1: 1) |
| Synonymer |
Oktansyre, compd.with 2-aminoetanol (1:1); Kaprylsyre, monoetanolamin salt; Monoetanolamin kaprylat; Monoetanolamin oktanoat; Oktansyre, forbindelse med 2-aminoetanol (1: 1); oktansyre - 2-aminoetanol (1: 1) |
| Engelsk navn |
octanoic acid, compound with 2-aminoethanol (1:1);Octanoic acid, compd. with 2-aminoethanol (1:1); Caprylic acid, monoethanolamine salt; Monoethanolamine caprylate; Monoethanolamine octanoate; Octanoic acid, compound with 2-aminoethanol (1:1); octanoic acid - 2-aminoethanol (1:1) |
| Molekylær Formel |
C10H23NO3 |
| Molekylvekt |
205.2945 |
| InChI |
InChI=1/C8H16O2.C2H7NO/c1-2-3-4-5-6-7-8(9)10;3-1-2-4/h2-7H2,1H3,(H,9,10);4H,1-3H2 |
| CAS-nummer |
28098-03-5 |
| EINECS |
248-838-8 |
| Molecular Structure |
|
| Kokepunkt |
239.3°C at 760 mmHg |
| Flammepunktet |
107.4°C |
| Damptrykk |
0.022mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
|
|
