ChemNet > CAS > 2832-10-2 Ethyl 4-acetyl-5-oxohexanoate
2832-10-2 Ethyl 4-acetyl-5-oxohexanoate
produktnavn |
Ethyl 4-acetyl-5-oxohexanoate |
Engelsk navn |
Ethyl 4-acetyl-5-oxohexanoate; Ethyl 4,4-diacetylbutyrate; 4-Acetyl-5-oxohexanoic acid ethyl ester; 2-(Ethoxycarbonylethyl)acetylacetone~Ethyl 4,4-diacetylbutyrate; ethyl (4E)-4-acetyl-5-hydroxyhex-4-enoate |
Molekylær Formel |
C10H16O4 |
Molekylvekt |
200.2316 |
InChI |
InChI=1/C10H16O4/c1-4-14-10(13)6-5-9(7(2)11)8(3)12/h11H,4-6H2,1-3H3/b9-7+ |
CAS-nummer |
2832-10-2 |
Molecular Structure |
|
Tetthet |
1.082g/cm3 |
Kokepunkt |
314.6°C at 760 mmHg |
Brytningsindeks |
1.468 |
Flammepunktet |
117.7°C |
Damptrykk |
3.97E-05mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|