2873-74-7 Glutaryl dichloride
produktnavn |
Glutaryl dichloride |
Engelsk navn |
Glutaryl dichloride; Glutaryl chloride; Pentanedioyl dichloride~1,3-Propanedicarbonyl chloride; pentanedioyl dichloride |
Molekylær Formel |
C5H6Cl2O2 |
Molekylvekt |
169.0059 |
InChI |
InChI=1/C5H6Cl2O2/c6-4(8)2-1-3-5(7)9/h1-3H2 |
CAS-nummer |
2873-74-7 |
EINECS |
220-711-1 |
Molecular Structure |
|
Tetthet |
1.319g/cm3 |
Kokepunkt |
217.8°C at 760 mmHg |
Brytningsindeks |
1.458 |
Flammepunktet |
106.7°C |
Damptrykk |
0.13mmHg at 25°C |
Hazard symboler |
C:Corrosive;
|
Risiko Koder |
R22:Harmful if swallowed.;
R34:Causes burns.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|