ChemNet > CAS > 2905-69-3 Methyl 2,5-dichlorobenzoate
2905-69-3 Methyl 2,5-dichlorobenzoate
produktnavn |
Methyl 2,5-dichlorobenzoate |
Engelsk navn |
Methyl 2,5-dichlorobenzoate; 2,5-Dichlorobenzoic acid methyl ester |
Molekylær Formel |
C8H6Cl2O2 |
Molekylvekt |
205.038 |
InChI |
InChI=1/C8H6Cl2O2/c1-12-8(11)6-4-5(9)2-3-7(6)10/h2-4H,1H3 |
CAS-nummer |
2905-69-3 |
EINECS |
220-815-7 |
Molecular Structure |
|
Tetthet |
1.355g/cm3 |
Kokepunkt |
265.2°C at 760 mmHg |
Brytningsindeks |
1.545 |
Flammepunktet |
113.2°C |
Damptrykk |
0.0093mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|