ChemNet > CAS > 2912-62-1 DL-2-klor-2-fenylacetyklorid
2912-62-1 DL-2-klor-2-fenylacetyklorid
produktnavn |
DL-2-klor-2-fenylacetyklorid |
Synonymer |
Klor(fenyl)acetylklorid; CCRIS 8624; (2S)-klor(fenyl)etanoylklorid; (2R)-klor(fenyl)etanoylklorid |
Engelsk navn |
DL-2-Chloro-2-phenylacetyl chloride;Chloro(phenyl)acetyl chloride; CCRIS 8624; (2S)-chloro(phenyl)ethanoyl chloride; (2R)-chloro(phenyl)ethanoyl chloride |
Molekylær Formel |
C8H6Cl2O |
Molekylvekt |
189.0386 |
InChI |
InChI=1/C8H6Cl2O/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7H/t7-/m1/s1 |
CAS-nummer |
2912-62-1 |
EINECS |
220-826-7 |
Molecular Structure |
|
Tetthet |
1.322g/cm3 |
Kokepunkt |
228°C at 760 mmHg |
Brytningsindeks |
1.55 |
Flammepunktet |
104.4°C |
Damptrykk |
0.0753mmHg at 25°C |
Hazard symboler |
C:Corrosive;
|
Risiko Koder |
R34:Causes burns.;
R36/37:Irritating to eyes and respiratory system.;
|
Sikkerhet Beskrivelse |
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|