ChemNet > CAS > 29338-49-6 1,1-Diphenyl-2-propanol
29338-49-6 1,1-Diphenyl-2-propanol
produktnavn |
1,1-Diphenyl-2-propanol |
Engelsk navn |
1,1-Diphenyl-2-propanol;alpha-Methyl-beta-phenylphenethyl alcohol; 1,1-diphenylpropan-2-ol; (2S)-1,1-diphenylpropan-2-ol; (2R)-1,1-diphenylpropan-2-ol |
Molekylær Formel |
C15H16O |
Molekylvekt |
212.2869 |
InChI |
InChI=1/C15H16O/c1-12(16)15(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-12,15-16H,1H3/t12-/m1/s1 |
CAS-nummer |
29338-49-6 |
EINECS |
249-574-6 |
Molecular Structure |
|
Tetthet |
1.058g/cm3 |
Smeltepunkt |
59-63℃ |
Kokepunkt |
329°C at 760 mmHg |
Brytningsindeks |
1.575 |
Flammepunktet |
135.3°C |
Damptrykk |
7.36E-05mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|