300-08-3 Arecoline hydrobromide
produktnavn |
Arecoline hydrobromide |
Engelsk navn |
Arecoline hydrobromide;methyl 1,2,5,6-tetrahydro-1-methyl-3-pyridinecarboxylate hydrobromide; methyl 1-methyl-1,2,5,6-tetrahydropyridine-3-carboxylate hydrobromide (1:1); 1-Methyl-1,2,5,6-tetrahydro-3-pyridinecarboxylic acid methyl ester hydrobromide; Arecoline HBr |
Molekylær Formel |
C8H14BrNO2 |
Molekylvekt |
236.1063 |
InChI |
InChI=1/C8H13NO2.BrH/c1-9-5-3-4-7(6-9)8(10)11-2;/h4H,3,5-6H2,1-2H3;1H |
CAS-nummer |
300-08-3 |
EINECS |
206-087-3 |
Molecular Structure |
|
Smeltepunkt |
171-174℃ |
Kokepunkt |
209°C at 760 mmHg |
Flammepunktet |
81.1°C |
Damptrykk |
0.208mmHg at 25°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R22:;
|
Sikkerhet Beskrivelse |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S38:In case of insufficient ventilation, wear suitable respiratory equipment.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|