3033-82-7 8-Chloroquinaldine
produktnavn |
8-Chloroquinaldine |
Engelsk navn |
8-Chloroquinaldine; 8-Chloro-2-methylquinoline; 2-Methyl-8-chloroquinoline |
Molekylær Formel |
C10H8ClN |
Molekylvekt |
177.6302 |
InChI |
InChI=1/C10H8ClN/c1-7-5-6-8-3-2-4-9(11)10(8)12-7/h2-6H,1H3 |
CAS-nummer |
3033-82-7 |
Molecular Structure |
|
Tetthet |
1.225g/cm3 |
Smeltepunkt |
64-66℃ |
Kokepunkt |
278.2°C at 760 mmHg |
Brytningsindeks |
1.634 |
Flammepunktet |
148.7°C |
Damptrykk |
0.00732mmHg at 25°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|