30544-34-4 2,3-Dibromofuran
produktnavn |
2,3-Dibromofuran |
Engelsk navn |
2,3-Dibromofuran; |
Molekylær Formel |
C4H2Br2O |
Molekylvekt |
225.8661 |
InChI |
InChI=1/C4H2Br2O/c5-3-1-2-7-4(3)6/h1-2H |
CAS-nummer |
30544-34-4 |
Molecular Structure |
|
Tetthet |
2.159g/cm3 |
Kokepunkt |
175.6°C at 760 mmHg |
Brytningsindeks |
1.562 |
Flammepunktet |
60°C |
Damptrykk |
1.53mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R36/38:Irritating to eyes and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|