ChemNet > CAS > 30595-79-0 2,6-Dichlorophenethylalcohol
30595-79-0 2,6-Dichlorophenethylalcohol
produktnavn |
2,6-Dichlorophenethylalcohol |
Engelsk navn |
2,6-Dichlorophenethylalcohol;2-(2,6-dichlorophenyl)ethanol |
Molekylær Formel |
C8H8Cl2O |
Molekylvekt |
191.0545 |
InChI |
InChI=1/C8H8Cl2O/c9-7-2-1-3-8(10)6(7)4-5-11/h1-3,11H,4-5H2 |
CAS-nummer |
30595-79-0 |
Molecular Structure |
|
Tetthet |
1.329g/cm3 |
Smeltepunkt |
59℃ |
Kokepunkt |
276.6°C at 760 mmHg |
Brytningsindeks |
1.569 |
Flammepunktet |
117.2°C |
Damptrykk |
0.00229mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|