ChemNet > CAS > 30711-40-1 2-(n-Heptanoyl)thiophene
30711-40-1 2-(n-Heptanoyl)thiophene
produktnavn |
2-(n-Heptanoyl)thiophene |
Engelsk navn |
2-(n-Heptanoyl)thiophene; 1-(2-Thienoyl)hexane; 1-(thiophen-2-yl)heptan-1-one |
Molekylær Formel |
C11H16OS |
Molekylvekt |
196.3091 |
InChI |
InChI=1/C11H16OS/c1-2-3-4-5-7-10(12)11-8-6-9-13-11/h6,8-9H,2-5,7H2,1H3 |
CAS-nummer |
30711-40-1 |
Molecular Structure |
|
Tetthet |
1.017g/cm3 |
Kokepunkt |
295.9°C at 760 mmHg |
Brytningsindeks |
1.511 |
Flammepunktet |
132.7°C |
Damptrykk |
0.00149mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|