ChemNet > CAS > 3088-42-4 N-(2-Cyanoethyl)glycine
3088-42-4 N-(2-Cyanoethyl)glycine
| produktnavn |
N-(2-Cyanoethyl)glycine |
| Engelsk navn |
N-(2-Cyanoethyl)glycine; N-(2-Cyanoehtyl)glycine |
| Molekylær Formel |
C5H8N2O2 |
| Molekylvekt |
128.1292 |
| InChI |
InChI=1/C5H8N2O2/c6-2-1-3-7-4-5(8)9/h7H,1,3-4H2,(H,8,9) |
| CAS-nummer |
3088-42-4 |
| EINECS |
221-418-1 |
| Molecular Structure |
|
| Tetthet |
1.187g/cm3 |
| Smeltepunkt |
188-193℃ |
| Kokepunkt |
343.1°C at 760 mmHg |
| Brytningsindeks |
1.473 |
| Flammepunktet |
161.3°C |
| Damptrykk |
1.3E-05mmHg at 25°C |
| Hazard symboler |
 Xn:Harmful;
|
| Risiko Koder |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Sikkerhet Beskrivelse |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|
