3096-57-9 2-Amino-9-fluorenone
produktnavn |
2-Amino-9-fluorenone |
Engelsk navn |
2-Amino-9-fluorenone; Aminofluorenone; 2-amino-9H-fluoren-9-one |
Molekylær Formel |
C13H9NO |
Molekylvekt |
195.2167 |
InChI |
InChI=1/C13H9NO/c14-8-5-6-10-9-3-1-2-4-11(9)13(15)12(10)7-8/h1-7H,14H2 |
CAS-nummer |
3096-57-9 |
EINECS |
221-445-9 |
Molecular Structure |
|
Tetthet |
1.327g/cm3 |
Smeltepunkt |
152-157℃ |
Kokepunkt |
426.4°C at 760 mmHg |
Brytningsindeks |
1.72 |
Flammepunktet |
211.7°C |
Damptrykk |
1.77E-07mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|