ChemNet > CAS > 31604-39-4 N-(4-Nitrophenyl)phthalimide
31604-39-4 N-(4-Nitrophenyl)phthalimide
| produktnavn |
N-(4-Nitrophenyl)phthalimide |
| Engelsk navn |
N-(4-Nitrophenyl)phthalimide; N-(4-Nitrophenyl)-phthalamide; 2-(4-nitrophenyl)-1H-isoindole-1,3(2H)-dione |
| Molekylær Formel |
C14H8N2O4 |
| Molekylvekt |
268.2243 |
| InChI |
InChI=1/C14H8N2O4/c17-13-11-3-1-2-4-12(11)14(18)15(13)9-5-7-10(8-6-9)16(19)20/h1-8H |
| CAS-nummer |
31604-39-4 |
| Molecular Structure |
|
| Tetthet |
1.501g/cm3 |
| Kokepunkt |
494.2°C at 760 mmHg |
| Brytningsindeks |
1.694 |
| Flammepunktet |
252.7°C |
| Damptrykk |
6.56E-10mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
