ChemNet > CAS > 31805-83-1 1,3-Bis(methylthio)-2-propanol
31805-83-1 1,3-Bis(methylthio)-2-propanol
produktnavn |
1,3-Bis(methylthio)-2-propanol |
Engelsk navn |
1,3-Bis(methylthio)-2-propanol;1,3-Bis(methylthio)propan-2-ol; 1,3-bis(methylsulfanyl)propan-2-ol |
Molekylær Formel |
C5H12OS2 |
Molekylvekt |
152.2782 |
InChI |
InChI=1/C5H12OS2/c1-7-3-5(6)4-8-2/h5-6H,3-4H2,1-2H3 |
CAS-nummer |
31805-83-1 |
EINECS |
250-814-7 |
Molecular Structure |
|
Tetthet |
1.112g/cm3 |
Kokepunkt |
278.4°C at 760 mmHg |
Brytningsindeks |
1.536 |
Flammepunktet |
135.8°C |
Damptrykk |
0.000523mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|